| Identification | |
| Name: | Benzenepropanoic acid,2-fluoro- |
| Synonyms: | Hydrocinnamicacid, o-fluoro- (7CI,8CI);2-Fluorobenzenepropanoic acid;3-(2-Fluorophenyl)propanoic acid;o-Fluorohydrocinnamic acid; |
| CAS: | 1643-26-1 |
| Molecular Formula: | C9H9FO2 |
| Molecular Weight: | 168.16 |
| InChI: | InChI=1/C9H9FO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 74-78 oC |
| Density: | g/cm3 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
