| Identification |
| Name: | Malonyl dichloride |
| Synonyms: | Malonylchloride (6CI,7CI,8CI);1,3-Dichloro-1,3-propanedione;Malonic acid chloride;Malonic acid dichloride;Malonoyl dichloride;Malonyldichloride;NSC 66410; |
| CAS: | 1663-67-8 |
| EINECS: | 216-772-9 |
| Molecular Formula: | C3H2Cl2O2 |
| Molecular Weight: | 140.95 |
| InChI: | InChI=1/C3H2Cl2O2/c4-2(6)1-3(5)7/h1H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Melting Point: | 53-55ºC |
| Density: | 1.449 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.462-1.466 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | Orange to brown liquid. Biting odor. |
| Packinggroup: | II |
| HS Code: | 29171990 |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
