| Identification | |
| Name: | Ethyl malonyl chloride |
| Synonyms: | Aceticacid, (chloroformyl)-, ethyl ester (6CI,7CI);(Chlorocarbonyl)acetic acid ethylester;(Chloroformyl)acetic acid ethyl ester;(Ethoxycarbonyl)acetyl chloride;2-(Ethoxycarbonyl)acetyl chloride;3-Chloro-3-oxopropanoic acid ethyl ester;Carbethoxyacetyl chloride;Carbethoxyethanoyl chloride;Carboethoxyacetylchloride;Ethoxymalonyl chloride;Ethyl (chlorocarbonyl)acetate;Ethyl(chloroformyl)acetate;Ethyl 3-chloro-3-oxopropanoate;Ethyl3-chloro-3-oxopropionate;Ethyl 3-oxo-3-chloropropanoate; |
| CAS: | 36239-09-5 |
| EINECS: | 252-934-5 |
| Molecular Formula: | C5H7ClO3 |
| Molecular Weight: | 150.56 |
| InChI: | InChI=1/C5H7ClO3/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.17 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.425-1.431 |
| Water Solubility: | REACTS |
| Solubility: | Reacts with water |
| Appearance: | clear yellow to brown liquid |
| Specification: |
Ethyl malonyl chloride , its cas register number is 36239-09-5. It also can be called Propanoic acid, 3-chloro-3-oxo-, ethyl ester ; Ethyl (chloroformyl)acetate ; Ethyl 3-chloro-3-oxopropionate .It is a clear yellow to brown liquid. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
