| Identification |
| Name: | Benzene,1-nitro-4-[(1E)-2-phenylethenyl]- |
| Synonyms: | Benzene,1-nitro-4-(2-phenylethenyl)-, (E)-; Stilbene, 4-nitro-, (E)- (8CI);(E)-1-(4-Nitrophenyl)-2-phenylethene; (E)-4-Nitrostilbene;1-Nitro-4-[(1E)-2-phenylethenyl]benzene; 4-Nitro-trans-stilbene; NSC 66821;trans-4-Nitrostilbene; trans-p-Nitrostilbene |
| CAS: | 1694-20-8 |
| EINECS: | 223-653-5 |
| Molecular Formula: | C14H11 N O2 |
| Molecular Weight: | 225.26 |
| InChI: | InChI=1/C14H11NO2/c16-15(17)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-11H/b7-6+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153.5°C |
| Boiling Point: | 342.8°Cat760mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.685 |
| Specification: |
trans-4-Nitrostilbene (CAS NO.1694-20-8) in the presence of N, N-dimethylaniline forms donor-acceptor complexes and slowly goes over to the trans form; the stability of this complex is approximately four times as great as that of the complex of N,N-dimethylaniline with nitrobenzene.
|
| Flash Point: | 153.5°C |
| Safety Data |
| Hazard Symbols |
|
| |
 |