| Identification | |
| Name: | L-4-Nitrophenylalanine methyl ester hydrochloride |
| CAS: | 17193-40-7 |
| Molecular Formula: | C10H13ClN2O4 |
| Molecular Weight: | 260.67 |
| InChI: | InChI=1/C10H12N2O4.ClH/c1-16-10(13)9(11)6-7-2-4-8(5-3-7)12(14)15;/h2-5,9H,6,11H2,1H3;1H/t9-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | g/cm3 |
| Specification: |
L-4-Nitrophenylalanine methyl ester hydrochloride , with CAS number of 17193-40-7, can be called L-phenylalanine, 4-nitro-, methyl ester, hydrochloride (1:1) ; Methyl 4-nitro-L-phenylalaninate hydrochloride (1:1) ; 4-Nitro-L-phenylalanine Methyl Ester Hydrochloride ; Methyl 4-nitro-L-phenylalaninate hydrochloride ; p-Nitrophenylalanine methyl ester hydrochloride . |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
