| Identification | |
| Name: | 2-Amino-5-nitrobenzophenone |
| Synonyms: | - |
| CAS: | 1775-95-7 |
| EINECS: | 217-207-9 |
| Molecular Formula: | C13H10N2O3 |
| Molecular Weight: | 242.23 |
| InChI: | InChI=1/C13H10N2O3/c14-12-7-6-10(15(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,14H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.333 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.657 |
| Water Solubility: | 3 mg/L (20 C) |
| Appearance: | yellow solid |
| Specification: |
2-Amino-5-nitrobenzophenone (CAS NO.1775-95-7) is also named as (2-Amino-5-nitrophenyl)phenylmethanone ; 4-14-00-00246 (Beilstein Handbook Reference) ; BRN 0748830 ; Methanone, (2-amino-5-nitrophenyl)phenyl- . 2-Amino-5-nitrobenzophenone (CAS NO.1775-95-7) is yellow solid. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A metabolite of Nitrazepam |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
