| Identification | |
| Name: | 2-Chloro-5-nitrobenzophenone |
| Synonyms: | - |
| CAS: | 34052-37-4 |
| EINECS: | 251-811-3 |
| Molecular Formula: | C13H8ClNO3 |
| Molecular Weight: | 261.66 |
| InChI: | InChI=1/C13H8ClNO3/c14-12-7-6-10(15(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.367 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.623 |
| Appearance: | light yellow to light brown crystalline powder |
| Specification: |
2-Chloro-5-nitrobenzophenone (CAS NO.34052-37-4) is also named as Methanone,(2-chloro-5-nitrophenyl)phenyl- ; Benzophenone,2-chloro-5-nitro- (6CI,8CI) ; (2-Chloro-5-nitrophenyl)phenyl)methanone ; 5-Nitro-2-chlorobenzophenone . 2-Chloro-5-nitrobenzophenone (CAS NO.34052-37-4) is light yellow to light brown crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
