| Identification |
| Name: | 2-Quinolinecarboxylicacid, 7-chloro-4-hydroxy- |
| Synonyms: | Kynurenicacid, 7-chloro- (6CI);Quinaldic acid, 7-chloro-4-hydroxy- (8CI);7-Chloro-4-hydroxyquinaldic acid;7-Chlorokynurenic acid;7-Chloroquinurenicacid;NSC 149792; |
| CAS: | 18000-24-3 |
| EINECS: | 241-913-6 |
| Molecular Formula: | C10H6ClNO3 |
| Molecular Weight: | 223.61254 |
| InChI: | InChI=1S/C10H6ClNO3/c11-5-1-2-6-7(3-5)12-8(10(14)15)4-9(6)13/h1-4H,(H,12,13)(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.549 g/cm3 |
| Refractive index: | 1.648 |
| Water Solubility: | Soluble in DMSO (10 mg/ml-clear, colorless to faint yellow solution) |
| Solubility: | Soluble in DMSO (10 mg/ml-clear, colorless to faint yellow solution) |
| Appearance: | White to yellowish powder |
| Biological Activity: | NMDA receptor antagonist acting at the glycine site. Potent competitive inhibitor of L-glutamate transport into synaptic vesicles. Also available as part of the NMDA Receptor - Glycine Site Tocriset™ . |
| Color: | tan |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
