| Identification | |
| Name: | Benzene,1-bromo-2-fluoro-4-nitro- |
| Synonyms: | 4-Bromo-3-fluoronitrobenzene;3-Fluoro-4-bromonitrobenzene; |
| CAS: | 185331-69-5 |
| Molecular Formula: | C6H3BrFNO2 |
| Molecular Weight: | 220 |
| InChI: | InChI=1/C6H3BrFNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 106.7°C |
| Boiling Point: | 252.9°C at 760 mmHg |
| Density: | 1.808g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
1-Bromo-2-fluoro-4-nitrobenzene , with CAS number of 185331-69-5, can be called 3-Fluoro-4-bromonitrobenzene ; 4-Bromo-3-fluoronitrobenzene ; 1-Bromo-2-fluoro-4-nitrobenzene . |
| Flash Point: | 106.7°C |
| Safety Data | |
 |
|
