| Identification | |
| Name: | Benzene,2-fluoro-1-methoxy-4-nitro- |
| Synonyms: | Anisole,2-fluoro-4-nitro- (6CI,8CI);2-Fluoro-1-methoxy-4-nitrobenzene;3-Fluoro-4-methoxynitrobenzene;NSC 10335; |
| CAS: | 455-93-6 |
| Molecular Formula: | C7H6FNO3 |
| Molecular Weight: | 171.13 |
| InChI: | InChI=1/C7H7FN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.321 g/cm3 |
| Refractive index: | 1.552 |
| Appearance: | Yellow powder |
| Specification: | White to light yellow crystalline powder Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
