| Identification | |
| Name: | Benzeneaceticacid, 3-chloro- |
| Synonyms: | Aceticacid, (m-chlorophenyl)- (7CI,8CI);(3-Chlorophenyl)acetic acid;(m-Chlorophenyl)acetic acid;2-(3-Chlorophenyl)acetic acid;NSC 87556; |
| CAS: | 1878-65-5 |
| EINECS: | 217-520-0 |
| Molecular Formula: | C8H7ClO2 |
| Molecular Weight: | 170.59 |
| InChI: | InChI=1/C8H7ClO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.7°C |
| Boiling Point: | 294.1°Cat760mmHg |
| Density: | 1.324g/cm3 |
| Stability: | No data. |
| Water Solubility: | methanol: 0.1 g/mL, clear, colorless |
| Solubility: | methanol: 0.1 g/mL, clear, colorless |
| Appearance: | white shiny flakes and chunks |
| Specification: |
3-Chlorophenylacetic acid (CAS No.933-88-0), it also can be called m-Chlorophenylacetic acid ; 3-Chlorobenzeneacetic acid . It is white shiny flakes and chunks. |
| HS Code: | 29163900 |
| Flash Point: | 131.7°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
