| Identification |
| Name: | Benzeneaceticacid, 3-hydroxy- |
| Synonyms: | Aceticacid, (m-hydroxyphenyl)- (7CI,8CI);(3-Hydroxyphenyl)acetic acid;(m-Hydroxyphenyl)acetic acid;2-(3-Hydroxyphenyl)acetic acid;3-Hydroxybenzeneaceticacid;NSC 14360; |
| CAS: | 621-37-4 |
| EINECS: | 210-684-4 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 179.1 ºC |
| Boiling Point: | 349 ºCat 760 mmHg |
| Density: | 1.319 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White to light beige powder. |
| HS Code: | 29182990 |
| Flash Point: | 179.1 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
