| Identification | |
| Name: | 2,6-Difluorobenzonitrile |
| Synonyms: | 2,6-Difluorobenzonitril; 2,6-Difluorobenzonitrole |
| CAS: | 1897-52-5 |
| EINECS: | 217-589-7 |
| Molecular Formula: | C7H3F2N |
| Molecular Weight: | 139.1 |
| InChI: | InChI=1/C7H3F2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.24 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4875 |
| Appearance: | White powder |
| Specification: |
? 2,6-Difluorobenzonitrile (CAS NO.1897-52-5), its Synonyms are Benzonitrile, 2,6-difluoro- ; 2,6-Difluoro-benzonitril ; 2,6-Difluorobenzonitrile 99% . It is white to light yellow crystal powder. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
