| Identification | |
| Name: | 3,5-Difluorobenzonitrile |
| Synonyms: | 5-CYANO-1,3-DIFLUOROBENZENE;3,5-DIFLUOROBENZONITRILE;LABOTEST-BB LT00847812;3,5-Difluorobenzonitril;Benzonitrile, 3,5-difluoro- (9CI);3,5-Difluorobenzonitrile,99%;3,5-DIFLUOROBENZEONITRILE;3,5-Difluorobenzonitrile98% |
| CAS: | 64248-63-1 |
| EINECS: | 264-752-3 |
| Molecular Formula: | C7H3F2N |
| Molecular Weight: | 139.102226 |
| InChI: | InChI=1S/C7H3F2N/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.26 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.486 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | white solid |
| Specification: | white crystals Safety Statements:26-36-36/37/39-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
