| Identification |
| Name: | D-Gluconic acid,2-(acetylamino)-2-deoxy-, d-lactone |
| Synonyms: | Gluconicacid, 2-acetamido-2-deoxy-, d-lactone, D- (8CI); 2-Acetamido-2-deoxy-D-glucono-(1®5)-lactone; 2-Acetamido-2-deoxy-D-gluconolactone;2-Acetamido-2-deoxygluconolactone; CD 80110; N-Acetylglucosamino-1,5-lactone;N-Acetylglucosaminono-(1®5)-lactone |
| CAS: | 19026-22-3 |
| EINECS: | 242-761-3 |
| Molecular Formula: | C8H13 N O6 |
| Molecular Weight: | 219.1919 |
| InChI: | InChI=1/C8H13NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-7,10,12-13H,2H2,1H3,(H,9,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.5 g/cm3 |
| Refractive index: | 1.56 |
| Appearance: | White Crystalline Solid |
| Usage: | Used to inhibit breakdown of products by beta-hexosaminidase(s) when the culture medium is used as an enzyme source |
| Safety Data |
| |
 |
