Identification |
Name: | D-Gluconic acid,2-amino-2-deoxy- |
Synonyms: | Gluconicacid, 2-amino-2-deoxy-, D- (8CI);2-Amino-2-deoxy-D-gluconic acid;D-Glucosamicacid;D-Glucosaminic acid;Glucosaminic acid;NSC 37779;NSC 404265; |
CAS: | 3646-68-2 |
EINECS: | 222-879-1 |
Molecular Formula: | C6H13NO6 |
Molecular Weight: | 195.17 |
InChI: | InChI=1/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 336.7°C |
Boiling Point: | 633.2°C at 760 mmHg |
Density: | 1.662g/cm3 |
Refractive index: | -15 ° (C=2.5, 1mol/L HCl) |
Appearance: | White Crystalline Solid |
Flash Point: | 336.7°C |
Storage Temperature: | 2-8°C |
Usage: | A useful starting material for the synthesis of aldonic acids containing a free carboxyl group and having all hydroxyl functions esterified with a simple carboxylic acid are well established deriviatives |
Safety Data |
|
|