| Identification | |
| Name: | Carbamothioic acid,N,N-dipropyl-, S-propyl ester |
| Synonyms: | Carbamicacid, dipropylthio-, S-propyl ester (6CI,8CI); Carbamothioic acid, dipropyl-,S-propyl ester (9CI); Dipropylthiocarbamic acid S-propyl ester; PPTC;Perbulate; Propyl dipropylthiolcarbamate; R-1607; S-Propyldipropylthiocarbamate; S-n-Propyl N,N-dipropylthiocarbamate; Vanalate; Vernam;Vernolate |
| CAS: | 1929-77-7 |
| EINECS: | 217-681-7 |
| Molecular Formula: | C10H21 N O S |
| Molecular Weight: | 203.38 |
| InChI: | InChI=1/C10H21NOS/c1-4-7-11(8-5-2)10(12)13-9-6-3/h4-9H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3082 9/PG 3 |
| Flash Point: | 118.8°C |
| Boiling Point: | 272.8°Cat760mmHg |
| Density: | 0.959g/cm3 |
| Refractive index: | 1.479 |
| Solubility: | Miscible with common organic solvents, e.g. xylene, methyl isobutyl ketone, kerosene, acetone, ethanol In water, 90 mg/L at 25 deg C |
| Specification: |
Vernolate ,its CAS NO. is 1929-77-7,the synonyms is Carbamic acid, dipropylthio-, S-propyl ester ; Carbamothioic acid, dipropyl-, S-propyl ester ; Caswell No. 711 ; Dipropylcarbamothioic acid S-propyl ester ; Dipropylthiocarbamic acid S-propyl ester ; EINECS 217-681-7 ; EPA Pesticide Chemical Code 041404 ; Perbulate ; Propyl dipropylthiolcarbamate ; Propyl-N,N-dipropylthiolcarbamate ; R-1607 ; S-Propyl dipropylcarbamothioate ; S-Propyl dipropylthiocarbamate ; S-Propyl-N,N-dipropylthiocarbamate ; Surpass E ; Vernam E Vernam G Surpass E ; n-Propyldi-n-propylthiocarbamate . |
| Flash Point: | 118.8°C |
| Storage Temperature: | 0-6°C |
| Color: | Clear liquid |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
