| Identification | |
| Name: | (S)-(+)-2-Amino-3-methyl-1-butanol |
| Synonyms: | (2S)-2-amino-3-methyl-butan-1-ol;L-Valinol; |
| CAS: | 2026-48-4 |
| EINECS: | 217-975-5 |
| Molecular Formula: | C5H13NO |
| Molecular Weight: | 103.16 |
| InChI: | InChI=1/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.926 |
| Stability: | Stable under normal temperatures and pressures. Absorbs carbon dioxide from the air. |
| Refractive index: | 1.4538-1.4558 |
| Alpha: | 16 o (C=10,ETOH) |
| Solubility: | Very soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?L-2-Amino-3-methylbutan-1-ol , its cas register number is 2026-48-4. It also can be called L-2-Amino-3-methylbutan-1-ol ; L-(+)-Valinol ; (S)-(+)-2-Amino-3-methyl-1-butanol ;?(2S)-2-Amino-3-methylbutan-1-ol ; 1-Butanol, 2-amino-3-methyl-, (S)- .It is a white to light yellow crystal powder. |
| HS Code: | 29221980 |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
