| Identification | |
| Name: | 1-Butanol,2-amino-3-methyl-, (2R)- |
| Synonyms: | 1-Butanol,2-amino-3-methyl-, (R)-;1-Butanol, 2-amino-3-methyl-, D- (8CI);(-)-2-Amino-3-methyl-1-butanol;(-)-Valinol;(2R)-2-Amino-3-methylbutan-1-ol;(R)-2-Amino-3-methyl-1-butanol;(R)-2-Amino-3-methylbutanol;(R)-Valinol;D-Valinol;[(R)-1-(Hydroxymethyl)-2-methylpropyl]amine;D-Val-ol; |
| CAS: | 4276-09-9 |
| EINECS: | 217-975-5 |
| Molecular Formula: | C5H13NO |
| Molecular Weight: | 103.16 |
| InChI: | InChI=1S/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.455 |
| Alpha: | -16.5 o (C=10, ETOH) |
| Appearance: | clear liquid to white solid |
| Specification: |
? 1-Butanol,2-amino-3-methyl-, (2R)- , with CAS number of 4276-09-9, can be called (2S)-2-Amino-3-methyl-1-butanol ; (2S)-2-Amino-3-methylbutan-1-ol ; 1-butanol, 2-amino-3-methyl-, (2S)- ; S-Valinol ; (2S)-2-Amino-3-Methyl-Butan-1-Ol ; (R)-(-)-2-Amino-3-methyl-1-butanol ; (S)-(+)-2-Amino-3-methyl-1-butanol ; (S)-2-Amino-3-methyl-butan-1-ol . It is a?white to light yellow crystal powde. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
