| Identification | |
| Name: | Piperazine,1-(3-chloropropyl)-4-methyl-, hydrochloride (1:2) |
| Synonyms: | Piperazine,1-(3-chloropropyl)-4-methyl-, dihydrochloride (7CI,8CI,9CI);3-(4-Methyl-1-piperazinyl)propyl chloride dihydrochloride;1-(3-Chloropropyl)-4-methylpiperazine dihydrochloride;1-(3-Chloropropyl)-4-methylpiperazine HCl; |
| CAS: | 2031-23-4 |
| EINECS: | 217-981-8 |
| Molecular Formula: | C8H19Cl3N2 |
| Molecular Weight: | 249.61 |
| InChI: | InChI=1/C8H17ClN2.2ClH/c1-10-5-7-11(8-6-10)4-2-3-9;;/h2-8H2,1H3;2*1H |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Specification: |
1-(3-Chloropropyl)-4-methylpiperazine dihydrochloride , with CAS number of 2031-23-4, can be called piperazine, 1-(3-chloropropyl)-4-methyl-, hydrochloride (1:2) ; 1-(3-Chloropropyl)-4-methylpiperazine HCl . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
