| Identification | |
| Name: | Piperazine,1-(3-chlorophenyl)-4-(3-chloropropyl)-, hydrochloride (1:1) |
| Synonyms: | Piperazine,1-(3-chlorophenyl)-4-(3-chloropropyl)-, monohydrochloride (9CI); |
| CAS: | 52605-52-4 |
| EINECS: | 258-038-0 |
| Molecular Formula: | C13H18Cl2N2.HCl |
| Molecular Weight: | 309.66 |
| InChI: | InChI=1/C13H18Cl2N2.ClH/c14-5-2-6-16-7-9-17(10-8-16)13-4-1-3-12(15)11-13;/h1,3-4,11H,2,5-10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Appearance: | white or off-white crystalline powder |
| Specification: |
1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride , with CAS number of 52605-52-4, can be called piperazine, 1-(3-chlorophenyl)-4-(3-chloropropyl)-, hydrochloride (1:1) ; 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride (1:1) . |
| Storage Temperature: | Refrigerator |
| Usage: | An arylpiperazine compound which is an important intermediate in the preparation of various pharmaceuticals, such as Trazodone (T718500), used to treat depression and post-traumatic stress. Trazodone impurity F. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
