| Identification | |
| Name: | D-Glucose, 5-thio- |
| Synonyms: | 5-Thio-D-glucose;5-Thioglucose; NSC 204984; Thioglucose |
| CAS: | 20408-97-3 |
| EINECS: | 243-798-8 |
| Molecular Formula: | C6H12 O5 S |
| Molecular Weight: | 196.24 |
| InChI: | InChI=1/C6H12O5S/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.503 g/cm3 |
| Refractive index: | 1.707 |
| Specification: |
5-Thio-D-glucose ,its cas register number is 20408-97-3. It also can be called 5-Thio-Alpha-D-Glucose ; Glucose, 5-thio-, D- ; alpha-D-Glucothiopyranose and D-Glucose, 5-thio- . |
| Report: |
EPA Genetic Toxicology Program. |
| Safety Data | |
 |
|
