| Identification | |
| Name: | 4-Methyl-3-nitrophenol |
| Synonyms: | 3-Nitro-p-cresol; 4-Methyl-3-nitrophenole; Nitropcresol; 98%; 3-Nitro-4-Methylphenol |
| CAS: | 2042-14-0 |
| EINECS: | 218-044-6 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2446 |
| Boiling Point: | 276°C at 760 mmHg |
| Density: | 1.32 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.596 |
| Solubility: | Insoluble |
| Appearance: | Brown crystalline powder |
| Specification: |
?4-Methyl-3-nitrophenol , its CAS NO. is 2042-14-0, the synonyms are 3-Nitro-p-cresol ; p-Cresol, 3-nitro- ; 2-Nitro-4-hydroxytoluene ; 3-Nitro-4-methylphenol . |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
