| Identification | |
| Name: | Benzenamine,N-ethyl-N-methyl-4-(2-phenyldiazenyl)- |
| Synonyms: | Aniline,N-ethyl-N-methyl-p-(phenylazo)- (6CI,7CI,8CI); Benzenamine,N-ethyl-N-methyl-4-(phenylazo)- (9CI); 4-(Ethylmethylamino)azobenzene;N-Ethyl-N-methyl-p-aminoazobenzene |
| CAS: | 2058-66-4 |
| Molecular Formula: | C15H17 N3 |
| Molecular Weight: | 239.35 |
| InChI: | InChI=1/C15H17N3/c1-3-18(2)15-11-9-14(10-12-15)17-16-13-7-5-4-6-8-13/h4-12H,3H2,1-2H3/b17-16+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 186.1°C |
| Boiling Point: | 384.1°Cat760mmHg |
| Density: | 1.01g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
N-Ethyl-N-methyl-p-(phenylazo)aniline , its cas register number is 2058-66-4. It also can be called 4-(Methylethyl)aminoazobenzine ; 4-16-00-00454 (Beilstein Handbook Reference) ; 4-Ethylmethylaminoazobenzene ; BRN 0747766 ; N-Ethyl-N-methyl-4-(phenylazo)benzenamine ; N-Ethyl-N-methyl-p-aminoazobenzene ; N-Methyl-N-ethyl-p-aminoazobenzene ; p-Ethylmethylaminoazobenzene . When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 186.1°C |
| Safety Data | |
 |
|
