| Identification | |
| Name: | Benzenamine,N-ethyl-4-(2-phenyldiazenyl)- |
| Synonyms: | Aniline,N-ethyl-p-(phenylazo)- (6CI,7CI,8CI); Benzenamine, N-ethyl-4-(phenylazo)-(9CI); 4-(Ethylamino)azobenzene; 4-Monoethylaminoazobenzene; EAB;N-Ethyl-4-aminoazobenzene |
| CAS: | 2058-67-5 |
| Molecular Formula: | C14H15 N3 |
| Molecular Weight: | 225.32 |
| InChI: | InChI=1/C14H15N3/c1-2-15-12-8-10-14(11-9-12)17-16-13-6-4-3-5-7-13/h3-11,15H,2H2,1H3/b17-16+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.1°C |
| Boiling Point: | 382.4°C at 760 mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.576 |
| Specification: |
N-Ethyl-4-aminoazobenzene , its cas register number is 2058-67-5. It also can be called N-Ethyl-p-(phenylazo)aniline ; Benzenamine, N-ethyl-4-(phenylazo)- ; N-Ethyl-4-(phenylazo)benzenamine ; and 4-(Ethylaminoazobenzene) . |
| Flash Point: | 185.1°C |
| Safety Data | |
 |
|
