| Identification | |
| Name: | Entecavir hydrate |
| Synonyms: | Baraclude;6H-Purin-6-one, 2-amino-1,9-dihydro-9-((1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-, monohydrate;Intermediates of drug, pesticide and dye;Enticavir;Entecavir hydrate / 2-Amino-1,9-dihydro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-purin-6-one monohydrate;Entecavir monohydrate;Entecavir API in stock;Entecavir(monohydrate)--Fine Product; |
| CAS: | 209216-23-9 |
| Molecular Formula: | C12H15N5O3.H2O |
| Molecular Weight: | 295.3 |
| InChI: | InChI=1/C12H15N5O3.H2O/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20;/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20);1H2/t6-,7+,8-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.81 |
| Appearance: | White crystalline powder |
| Specification: |
? Entecavir hydrate , with CAS number of 209216-23-9, can be called entecavir hydrate ; Entecavir monohydrate ; 2-Amino-1,9-dihydro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-purin-6-one monohydrate ; Entecavir hydrate / 2-Amino-1,9-dihydro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-purin-6-one monohydrate .?Entecavir hydrate (CAS NO.209216-23-9) ?is an oral antiviral drug used in the treatment of hepatitis B infection. |
| Safety Data | |
 |
|
