| Identification |
| Name: | 2'-Chloroacetophenone |
| Synonyms: | 1-(2-Chlorophenyl)ethanone; 2'-Chloroacetophenone; 1-(2-chlorophenyl)-ethanon; 2-Chlorophenyl methyl ketone; Methyl 2-chlorophenyl ketone; o-Chloroacetophonone; o-Chlorophenyl methyl ketone; o-Chlorophenylmethylketone; 1-(2-Chlorophenyl)ethanone |
| CAS: | 2142-68-9 |
| EINECS: | 218-397-6 |
| Molecular Formula: | C8H7ClO |
| Molecular Weight: | 154.59 |
| InChI: | InChI=1/C8H7ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3416 6 |
| Melting Point: | 52-56C |
| Density: | 1.188 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5428-1.5448 |
| Solubility: | Insoluble |
| Appearance: | Clear amber liquid. |
| Packinggroup: | II |
| HS Code: | 29147090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
