| Identification | |
| Synonyms: | 4-Chlorophenacyl bromide; 2-Bromo-4-chloroacetophenone; omega-bromo-4-chloroacetophenone; bromomethyl p-chlorophenyl ketone; 4-Chloro Phencyl Bromide; 2,4-Dichloropentaphenone; A-BROMO-P-CHLOROACETOPHENONE; ALPHA-BROMO-P-CHLOROACETOPHENONE; AKOS 90589; AKOS BBS-00000813; 4-CHLORO-2'-BROMINE ACETOPHENONE; 4-Chloro-2'-bromoacetophenone; 2-BROMO-1-(4-CHLOROPHENYL)ETHAN-1-ONE; 2-bromo-4'-chloroacetophenone; 2-bromo-1-(4-chlorophenyl)ethanone |
| CAS: | 536-38-9 |
| EINECS: | 208-631-5 |
| Molecular Formula: | C8H6BrClO |
| Molecular Weight: | 233.49 |
| InChI: | InChI=1/C8H6BrClO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Density: | 1.598g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Insoluble |
| Appearance: | White to beige solid. |
| Packinggroup: | III |
| Storage Temperature: | Keep Cold |
| Sensitive: | Lachrymatory |
| Usage: | Substance is used in the prepn of quaternary salts of methenamine and of chlorophenol glyoximes. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
