| Identification | |
| Name: | 2,4-Diacetylphloroglucinol |
| Synonyms: | 1,1'-(2,4,6-Trihydroxy-1,3-phenylene)bisethanone;Ethanone, 1,1'-(2,4,6-trihydroxy-1,3-phenylene)bis- (9CI) |
| CAS: | 2161-86-6 |
| Molecular Formula: | C10H10 O5 |
| Molecular Weight: | 210.18 |
| InChI: | InChI=1/C10H10O5/c1-4(11)8-6(13)3-7(14)9(5(2)12)10(8)15/h3,13-15H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 164 °C |
| Flash Point: | 194.6°C |
| Boiling Point: | 374.7°Cat760mmHg |
| Density: | 1.422g/cm3 |
| Refractive index: | 1.62 |
| Specification: | Light Pink Solid usageEng:A secondary metabolite of P. Fluorescens strain CHAO which is a pathogen suppressor as well as showing inhibitory effects on bacteria, fungi, and plants. Also show marked antiviral activity against both RNA virus with envelop (vesicular stomatitis virus) and a DNA Virus with envelop (herpes simplex virus type I). Furthermore, it showed antagonistic activity against both thromboxane A2 and leukotriene D4. |
| Flash Point: | 194.6°C |
| Usage: | A secondary metabolite of P. Fluorescens strain CHAO which is a pathogen suppressor as well as showing inhibitory effects on bacteria, fungi, and plants. Also show marked antiviral activity against both RNA virus with envelop (vesicular stomatit |
| Safety Data | |
 |
|
