| Identification |
| Name: | Oxirane,2-[(2-methylphenoxy)methyl]- |
| Synonyms: | Oxirane,[(2-methylphenoxy)methyl]- (9CI);Propane, 1,2-epoxy-3-(o-tolyloxy)-(6CI,7CI,8CI);(2-Methylphenoxymethyl)oxirane;1,2-Epoxy-3-(2-methylphenoxy)propane;1,2-Epoxy-3-(o-tolyloxy)propane;1-(2,3-Epoxypropoxy)-2-methylbenzene;1-(2-Methylphenoxy)-2,3-epoxypropane;1-(o-Methylphenoxy)-2,3-epoxypropane;2-Methylphenyl glycidyl ether;2-[(2-Methylphenoxy)methyl]oxirane;Araldite DY-K;Epodil 742;Glycidyl2-methylphenyl ether;Glycidyl o-methylphenyl ether;Glycidyl o-tolyl ether;Heloxy 62;Heloxy R Modifier 62;NSC 11571;NSC 20291;SY-OCG;o-Cresylglycidyl ether;CRESOL GLYCIDYL ETHER; |
| CAS: | 2210-79-9 |
| EINECS: | 218-645-3 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-8-4-2-3-5-10(8)12-7-9-6-11-9/h2-5,9H,6-7H2,1H3 |
| Molecular Structure: |
![(C10H12O2) Oxirane,[(2-methylphenoxy)methyl]- (9CI);Propane, 1,2-epoxy-3-(o-tolyloxy)-(6CI,7CI,8CI);(2-Methylph...](https://img.guidechem.com/casimg/2210-79-9.gif) |
| Properties |
| Transport: | UN 3082 |
| Density: | 1.079 |
| Stability: | The substance can presumably form explosive peroxides. |
| Refractive index: | 1.529 |
| Solubility: | Insoluble |
| Appearance: | Clear light yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
