| Identification | |
| Name: | 2-Chloro-3-methyl-5-nitropyridine |
| Synonyms: | 3-Picoline,2-chloro-5-nitro- (7CI,8CI);2-Chloro-5-nitro-3-picoline;6-Chloro-5-methyl-3-nitropyridine; |
| CAS: | 22280-56-4 |
| EINECS: | 244-889-5 |
| Molecular Formula: | C6H5ClN2O2 |
| Molecular Weight: | 172.57 |
| InChI: | InChI=1/C6H5ClN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.406 g/cm3 |
| Refractive index: | 1.575 |
| Appearance: | Light beige to cream colored crystalline powder |
| Specification: |
2-Chloro-3-methyl-5-nitropyridine (CAS NO.22280-56-4) is also named as Pyridine, 2-chloro-3-methyl-5-nitro- ; 2-Chloro-3-methyl-5-nitro pyridine ; 2-Chloro-5-nitro-3-picoline . It is light beige to cream colored crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
