| Identification |
| Name: | Guanidine, methyl-,hydrochloride (8CI,9CI) |
| Synonyms: | Methylguanidinehydrochloride |
| CAS: | 22661-87-6 |
| EINECS: | 245-147-3 |
| Molecular Formula: | C2H7 N3 . x Cl H |
| Molecular Weight: | 109.55802 |
| InChI: | InChI=1S/C2H7N3.ClH/c1-5-2(3)4;/h1H3,(H4,3,4,5);1H |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Water Solubility: | Soluble in water (50 mg/ml - clear, colorless to light yellow solution) |
| Solubility: | Soluble in water (50 mg/ml - clear, colorless to light yellow solution) |
| Appearance: | White to off-white crystalline powder |
| Storage Temperature: | −20°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
