| Identification | |
| Name: | Pyridine,2-bromo-4-methyl-3-nitro- |
| Synonyms: | 4-Picoline,2-bromo-3-nitro- (8CI); |
| CAS: | 23056-45-3 |
| Molecular Formula: | C6H5BrN2O2 |
| Molecular Weight: | 217.02 |
| InChI: | InChI=1/C6H5BrN2O2/c1-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 113°C |
| Boiling Point: | 263.3°Cat760mmHg |
| Density: | 1.709g/cm3 |
| Refractive index: | 1.599 |
| Specification: |
2-Bromo-4-methyl-3-nitropyridine with cas registry number of 23056-45-3 is also known as pyridine, 2-bromo-4-methyl-3-nitro- ; 2-Bromo-3-nitro-4-picoline ; 2-Bromo-4-methyl-3-nitro-pyridine . This compound is used as a intermediate . |
| Flash Point: | 113°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
