| Identification |
| Name: | Trimethoprim lactate salt |
| Synonyms: | Lactic acid, compound with 5-(3,4,5-trimethoxybenzyl)pyrimidine-2,4-diamine (1:1);Trimethoprim lactic Acid;2-hydroxypropanoic acid; 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine;Propanoic acid,2-hydroxy-,compounds,compd. with 5-[(3,4,5-trimethoxyphenyl)methyl]-2,4- pyrimidinediamine (1:1); |
| CAS: | 23256-42-0 |
| EINECS: | 245-533-1 |
| Molecular Formula: | C14H18N4O3.C3H6O3 |
| Molecular Weight: | 380.4 |
| InChI: | InChI=1/C14H18N4O3.C3H6O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15;1-2(4)3(5)6/h5-7H,4H2,1-3H3,(H4,15,16,17,18);2,4H,1H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Flash Point: | 271.9°C |
| Boiling Point: | 526°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: |
< |
| Appearance: | white to yellowish powder |
| Packinggroup: | III |
| Flash Point: | 271.9°C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
