Identification |
Name: | 4-Benzyloxy-3-methoxybenzaldehyde |
Synonyms: | o-Benzylvanillin; 4-(benzyloxy)-3-methoxy benzaldehyde |
CAS: | 2426-87-1 |
EINECS: | 219-379-0 |
Molecular Formula: | C15H14O3 |
Molecular Weight: | 242.27 |
InChI: | InChI=1/C15H14O3/c1-17-15-9-13(10-16)7-8-14(15)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 183.1°C |
Boiling Point: | 213-215°C 3,5mm |
Density: | 1.154g/cm3 |
Refractive index: | 1.59 |
Appearance: | Yellow crystalline powder or crystalline chunks |
Specification: | YELLOW CRYSTALLINE POWDER OR CRYSTALLINE CHUNKS Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Flash Point: | 183.1°C |
Storage Temperature: | Refrigerator, Under Inert Atmosphere |
Sensitive: | Air Sensitive |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|