| Identification | |
| Name: | 3-Fluoro-4-methoxybenzaldehyde |
| Synonyms: | p-Anisaldehyde,3-fluoro- (8CI);3-Fluoro-p-anisaldehyde;4-Methoxy-3-fluorobenzaldehyde; |
| CAS: | 351-54-2 |
| EINECS: | 206-514-3 |
| Molecular Formula: | C8H7FO2 |
| Molecular Weight: | 154.14 |
| InChI: | InChI=1/C8H7FO2/c1-11-8-3-2-6(5-10)4-7(8)9/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.192 g/cm3 |
| Refractive index: | 1.608 |
| Appearance: | white to light yellow low melting crystalline mass |
| Specification: |
3-Fluoro-4-methoxybenzaldehyde , its cas register number is 351-54-2. It also can be called 3-Fluoro-p-anisaldehyde .It is a white to light yellow low melting crystalline mass. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
