Identification |
Name: | 2-Chloro-5-nitrobenzoic acid |
Synonyms: | 5-nitro-2-chlorobenzoic acid |
CAS: | 2516-96-3 |
EINECS: | 219-739-7 |
Molecular Formula: | C7H4ClNO4 |
Molecular Weight: | 201.57 |
InChI: | InChI=1/C7H4ClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
Molecular Structure: |
|
Properties |
Transport: | 50kgs |
Density: | 1.6 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.627? |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | Yellow to brownish crystalline powder |
HS Code: | 29163900 |
Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|