| Identification |
| Name: | 5-methyl-2-nitrobenzoic acid |
| Synonyms: | 6-Nitro-m-toluic acid |
| CAS: | 3113-72-2 |
| EINECS: | 221-481-5 |
| Molecular Formula: | C8H7NO4 |
| Molecular Weight: | 181.14 |
| InChI: | InChI=1/C8H7NO4/c1-5-2-3-7(9(12)13)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 50kgs
|
| Flash Point: | 165°C |
| Boiling Point: | 363.8°Cat760mmHg |
| Density: | 1.392g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.6 |
| Water Solubility: | Insoluble
AUTOIGNITION |
| Solubility: | Insoluble
AUTOIGNITION |
| Appearance: | yellowish
to yellow crystalline powder |
| Flash Point: | 165°C |
| Safety Data |
| Hazard Symbols |
|
| |
 |
