| Identification | |
| Name: | 1,2-Benzenedicarboxylicacid, 1-(phenylmethyl) ester |
| Synonyms: | 1,2-Benzenedicarboxylicacid, mono(phenylmethyl) ester (9CI); Phthalic acid, benzyl ester(6CI,7CI,8CI); 2-[(Benzyloxy)carbonyl]benzoic acid; Benzyl hydrogen phthalate;Monobenzyl phthalate; NSC 402008 |
| CAS: | 2528-16-7 |
| EINECS: | 219-771-1 |
| Molecular Formula: | C15H12 O4 |
| Molecular Weight: | 256.27 |
| InChI: | InChI=1/C15H12O4/c16-14(17)12-8-4-5-9-13(12)15(18)19-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 106 °C |
| Flash Point: | 167.8°C |
| Boiling Point: | 441.1°Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | White Solid |
| Specification: | White Solid usageEng:Phthalate metabolite, which has been shown to influence preterm deliveries. |
| Flash Point: | 167.8°C |
| Storage Temperature: | Refrigerator |
| Usage: | Phthalate metabolite, which has been shown to influence preterm deliveries. |
| Safety Data | |
 |
|
