| Identification | |
| Name: | 2-Butenedioic acid(2E)-, butyl oxiranylmethyl ester (9CI) |
| Synonyms: | 2-Butenedioicacid (E)-, butyl oxiranylmethyl ester; Fumaric acid, butyl 2,3-epoxypropylester (8CI); 1-Propanol, 2,3-epoxy-, butyl fumarate (8CI); Butyl2,3-epoxypropyl fumarate; Butyl glycidyl fumarate |
| CAS: | 25876-07-7 |
| Molecular Formula: | C11H16 O5 |
| Molecular Weight: | 228.27 |
| InChI: | InChI=1/C11H16O5/c1-2-3-6-14-10(12)4-5-11(13)16-8-9-7-15-9/h4-5,9H,2-3,6-8H2,1H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 150.9°C |
| Boiling Point: | 342.4°Cat760mmHg |
| Density: | 1.152g/cm3 |
| Refractive index: | 1.479 |
| Specification: |
The extinguishing agent of Butyl 2,3-Epoxypropyl Fumarate (CAS NO.25876-07-7) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 150.9°C |
| Safety Data | |
 |
|
