| Identification | |
| Name: | 4-Hydroxyvalerophenone |
| Synonyms: | Valerophenone,4'-hydroxy- (7CI,8CI);1-(4-Hydroxyphenyl)-1-pentanone;4-Valerylphenol;1-Pentanone,1-(4-hydroxyphenyl)-;NSC 49186;NSC 49321;p-Hydroxyvalerophenone; |
| CAS: | 2589-71-1 |
| EINECS: | 219-978-7 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8,12H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.055 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.525 |
| Appearance: | white to light beige powder |
| Specification: |
4-Hydroxyvalerophenone (CAS NO.2589-71-1) is also called 1-Pentanone, 1-(4-hydroxyphenyl)- ; 4-Valerylphenol ; AI3-11694 ; NSC 49186 ; Valerophenone, 4'-hydroxy- ; p-Hydroxyvalerophenone ; p-Valerylphenol . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
