| Identification |
| Name: | 4-Aminobenzamide |
| Synonyms: | Fast Red Base DB-70; P-Amino-Benzamide |
| CAS: | 2835-68-9 |
| EINECS: | 220-612-3 |
| Molecular Formula: | C7H8N2O |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C7H8N2O/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H2,9,10) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.233 g/cm3 |
| Refractive index: | 1.632 |
| Appearance: | white to light tan powder |
| Specification: | off-white to beige crystalline powder Safety Statements:38-37/39-26-36 38:In case of insufficient ventilation, wear suitable respiratory
equipment 37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |