| Identification |
| Name: | Benzene,1-chloro-3-methoxy- |
| Synonyms: | Anisole,m-chloro- (6CI,7CI,8CI);1-Chloro-3-methoxybenzene;3-Chloroanisol;3-Chloromethoxybenzene;3-Methoxychlorobenzene;3-Methoxyphenyl chloride;m-Chloroanisole;m-Chloromethoxybenzene;m-Chlorophenyl methyl ether; |
| CAS: | 2845-89-8 |
| EINECS: | 220-642-7 |
| Molecular Formula: | C7H7ClO |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C7H7ClO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.164 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5345-1.5365 |
| Solubility: | insoluble |
| Appearance: | Clear light yellow liquid. |
| HS Code: | 29093090 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
