| Identification | |
| Name: | Dimethylaminoethyl methacrylate |
| Synonyms: | 2-(dimethylamino)ethyl methacrylate; 2-(Dimethylamino)ethyl methacrylate, stabilized with 0.2% MEHQ; 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester; DMAEMA; N,N-Dimethylaminoethyl methacrylate; DM; N,N-dimethyl-ethylamine methacrylate; |
| CAS: | 2867-47-2 |
| EINECS: | 220-688-8 |
| Molecular Formula: | C8H15NO2 |
| Molecular Weight: | 157.21 |
| InChI: | InChI=1/C8H15NO2/c1-7(2)8(10)11-6-5-9(3)4/h1,5-6H2,2-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2522 |
| Density: | 0.933 |
| Stability: | Stable. Incompatible with strong acids, strong bases, strong oxidizing or reducing agents. May decompose on exposure to air and moisture. May undergo autopolymerization. Light sensitive. |
| Refractive index: | 1.439-1.441 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | colourless liquid |
| Specification: |
?2-Dimethylaminoethyl methacrylate (CAS NO.2867-47-2) is also called as?2-(Dimethylamino)ethyl 2-methyl-2-propenoate ; 2-(Dimethylamino)ethyl methacrylate ; 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester ; Dimethylaminoethyl methacrylate ; N,N-Dimethylaminoethyl methacrylate?; 2-(Dimethylamino)ethyl methacrylate ; 2-(N,N-Dimethylamino)ethyl methacrylate ; 2-Dimethylaminoethylester kyseliny methakrylove ; 2-Dimethylaminoethylester kyseliny methakrylove [Czech] ; 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester ;?Ethanol, 2-(dimethylamino)-, methacrylate ;?Methacrylic acid, 2-(dimethylamino)ethyl ester ; N,N-Dimethylaminoethyl methacrylate ; N,N-Dimethylethanolamine methacrylate ;?beta-Dimethylaminoethyl methacrylate ; 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester ; Methacrylic acid, 2-(dimethylamino)ethyl ester ;?2-Dimethylaminoethyl methacrylate [UN2522] [Poison] . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29221980 |
| Color: | Liquid |
| Usage: | In binders for coatings, textile chemicals, dispersing agents for nonaqueous systems, antistatic agents, stabilizers for chlorinated polymers, ion exchange resins, emulsifying agents, cationic precipitating agents. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
