| Identification | |
| Name: | N-Benzyltropinone |
| Synonyms: | 1aH,5aH-Tropan-3-one, 9-phenyl- (8CI);3-Nortropanone,8-benzyl- (6CI,7CI);8-(Phenylmethyl)-8-azabicyclo[3.2.1]octan-3-one;8-Benzyl-1aH,5aH-nortropan-3-one;8-Benzyl-3-nortropanone;8-Benzyl-8-azabicyclo[3.2.1]octan-3-one;8-Benzylbicyclo[3.2.1]octan-3-one;N-Benzyl-3-tropinone; |
| CAS: | 28957-72-4 |
| EINECS: | 249-329-3 |
| Molecular Formula: | C14H17NO |
| Molecular Weight: | 215.29 |
| InChI: | InChI=1/C14H17NO/c16-14-8-12-6-7-13(9-14)15(12)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.14 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.556 |
| Appearance: | off-white to pale yellow low-melting solid |
| Specification: |
N-Benzyltropinone (28957-72-4) is also named as 8-azabicyclo[3.2.1]octan-3-one, 8-(phenylmethyl)- ; 8-Benzyl-8-azabicyclo(3.2.1)octan-3-one ; 8-Benzyl-8-azabicyclo[3.2.1]octan-3-on . N-Benzyltropinone (28957-72-4) is off-white to pale yellow low-melting solid. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
