| Identification |
| Name: | 4-Ethylresorcinol |
| Synonyms: | 4-Ethyl-1,3-benzenediol |
| CAS: | 2896-60-8 |
| EINECS: | 220-777-1 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-2-6-3-4-7(9)5-8(6)10/h3-5,9-10H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.159 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.578 |
| Solubility: | Slightly soluble |
| Appearance: | White to yellow crystals |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
