| Identification | |
| Name: | 2-Quinolinecarboxylicacid, 4-hydroxy-8-methoxy- |
| Synonyms: | Kynurenicacid, 8-methoxy- (6CI); Quinaldic acid, 4-hydroxy-8-methoxy- (7CI,8CI);4-Hydroxy-8-methoxyquinoline-2-carboxylic acid; 8-Methoxykynurenic acid;8-Methoxyxanthurenic acid; Xanthurenic acid 8-methyl ether |
| CAS: | 2929-14-8 |
| Molecular Formula: | C11H9 N O4 |
| Molecular Weight: | 219.21 |
| InChI: | InChI=1/C11H9NO4/c1-16-9-4-2-3-6-8(13)5-7(11(14)15)12-10(6)9/h2-5H,1H3,(H,12,13)(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 200°C |
| Boiling Point: | 407.1°Cat760mmHg |
| Density: | 1.402g/cm3 |
| Refractive index: | 1.611 |
| Specification: |
4-Hydroxy-8-methoxyquinaldic acid , its CAS NO. is 2929-14-8, the synonyms are 4-22-00-02513 (Beilstein Handbook Reference) ; 8-Methoxy-4-hydroxyquinoline-2-carboxylic acid ; 8-Methyl ether of xanthurenic acid ; BRN 0202789 ; Xanthurenic acid-8-methyl ether ; Quinaldic acid, 4-hydroxy-8-methoxy- . |
| Flash Point: | 200°C |
| Safety Data | |
 |
|
