| Identification | |
| Name: | 2-Chloronicotinic acid |
| Synonyms: | 2-Chloropyridine-3-carboxylic acid; 2-Chloro-3-pyridinecarboxylic acid |
| CAS: | 2942-59-8 |
| EINECS: | 220-937-0 |
| Molecular Formula: | C6H4ClNO2 |
| Molecular Weight: | 157.55446 |
| InChI: | InChI=1S/C6H4ClNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.47 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | off-white to brown powder |
| Specification: |
?2-Chloronicotinic acid , its cas register number is 2942-59-8. It also can be called 2-Chloro-3-pyridinecarboxylic acid ; Nicotinic acid, 2-chloro-?; 3-Pyridinecarboxylic acid, 2-chloro-?.It is a?white to cream powder. |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | An intermediate for agrochemicals, feed additives, pharmaceuticals and animal food enrichments. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
