| Identification | |
| Name: | L-erythro-Pentofuranose,2-deoxy- |
| Synonyms: | 2-Deoxy-L-erythro-pentofuranose; |
| CAS: | 29780-54-9 |
| Molecular Formula: | C5H10O4 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C5H10O4/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5?/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.453 g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
The 2-Deoxy-L-erythro-pentofuranose with the cas number 29780-54-9 is also called L-erythro-Pentofuranose,2-deoxy-. Its molecular formula is C5H10O4. The product category is Carbohydrates. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: -1.38; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1; (4)ACD/LogD (pH 7.4): -1; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 4; (8)ACD/KOC (pH 7.4): 4; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 69.92 Å2; (13)Index of Refraction: 1.551; (14)Molar Refractivity: 29.462 cm3; (15)Molar Volume: 92.304 cm3; (16)Polarizability: 11.68×10-24cm3; (17)Surface Tension: 62.264 dyne/cm; (18)Enthalpy of Vaporization: 70.491 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
