Identification |
Name: | D-erythro-Pentofuranose, 2-deoxy-, 1-acetate 3,5-dibenzoate |
Synonyms: | D-erythro-Pentofuranose, 2-deoxy-, 1-acetate 3,5-dibenzoate |
CAS: | 51255-12-0 |
Molecular Formula: | C21H20O7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C21H20O7/c1-14(22)26-19-12-17(28-21(24)16-10-6-3-7-11-16)18(27-19)13-25-20(23)15-8-4-2-5-9-15/h2-11,17-19H,12-13H2,1H3/t17-,18+,19?/m0/s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 98-100?C |
Flash Point: | 220.3°C |
Boiling Point: | 504.9°C at 760 mmHg |
Density: | 1.3g/cm3 |
Refractive index: | 1.58 |
Specification: | White Solid usageEng:A useful synthetic intermediate for the production of antiviral and anticancer research chemicals. |
Flash Point: | 220.3°C |
Storage Temperature: | Refrigerator |
Usage: | A useful synthetic intermediate for the production of antiviral and anticancer research chemicals. |
Safety Data |
|
|